1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione
Modify Date: 2026-07-06 23:03:52
![1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione Structure](https://www.chemsrc.com/extcaspic/209/2034381-33-2.png)
1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione structure
|
Common Name | 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 2034381-33-2 | Molecular Weight | 362.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H22N2O3 |
|---|---|
| Molecular Weight | 362.4 |
| InChIKey | XEGCNGGJUPBLTE-UHFFFAOYSA-N |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N1CC(N2C(=O)CCC2=O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione? |
| A: The English name of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione is 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione. |
| Q: What is the molecular formula of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione? |
| A: Molecular formula of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione is C22H22N2O3. |
| Q: What is the molecular weight of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione? |
| A: Molecular weight of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione is 362.4. |
| Q: What is the Chinese name of 2034381-33-2? |
| A: Chinese name of 2034381-33-2 is 2034381-33-2. |
| Q: What is the SMILES notation of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione? |
| A: SMILES notation of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione is O=C(CC(c1ccccc1)c1ccccc1)N1CC(N2C(=O)CCC2=O)C1. |
| Q: What is the InChIKey of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione? |
| A: InChIKey of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione is XEGCNGGJUPBLTE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione? |
| A: CAS number of 1-[1-(3,3-Diphenylpropanoyl)azetidin-3-yl]pyrrolidine-2,5-dione is 2034381-33-2. |