4-Methyl-2-nitrobenzaldehyde structure
|
Common Name | 4-Methyl-2-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 20357-22-6 | Molecular Weight | 165.14600 | |
| Density | 1.278 g/cm3 | Boiling Point | 309.4ºC at 760 mmHg | |
| Molecular Formula | C8H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.9ºC | |
| Name | 4-Methyl-2-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278 g/cm3 |
|---|---|
| Boiling Point | 309.4ºC at 760 mmHg |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.14600 |
| Flash Point | 154.9ºC |
| Exact Mass | 165.04300 |
| PSA | 62.89000 |
| LogP | 2.23890 |
| Vapour Pressure | 0.000642mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | FDYADQPZUDULNK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C=O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| p-Tolualdehyde,2-nitro |
| Benzaldehyde,4-methyl-2-nitro |
| 4-Methyl-2-nitro-benzaldehyd |
| 2-Nitro-4-methylbenzaldehyde |
| 4-methyl-2-nitro-benzaldehyde |