5-Methoxy-2-nitrobenzaldehyde structure
|
Common Name | 5-Methoxy-2-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 20357-24-8 | Molecular Weight | 181.145 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 354.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.2±25.7 °C | |
| Name | 5-methoxy-2-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.7±27.0 °C at 760 mmHg |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 184.2±25.7 °C |
| Exact Mass | 181.037506 |
| PSA | 72.12000 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | BNTDDWPHSMILHQ-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(C=O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2913000090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-nitro-5-methoxybenzaldehyde |
| 6-nitro-3-methoxybenzaldehyde |
| 2-Formyl-4-methoxynitrobenzene |
| MFCD00456498 |
| Benzaldehyde,5-methoxy-2-nitro |
| 3-methoxy-6-nitrobenzaldehyde |
| 5-Methoxy-2-nitrobenzaldehyde |
| 5-methoxy-2-nitro-benzaldehyde |
| 3-Formyl-4-nitroanisole |