1-Propanone,1-(4-methoxyphenyl)-2,2-dimethyl- structure
|
Common Name | 1-Propanone,1-(4-methoxyphenyl)-2,2-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 2040-26-8 | Molecular Weight | 192.25400 | |
| Density | 0.988g/cm3 | Boiling Point | 291.4ºC at 760mmHg | |
| Molecular Formula | C12H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.5ºC | |
| Name | 1-(4-methoxyphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.988g/cm3 |
|---|---|
| Boiling Point | 291.4ºC at 760mmHg |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.25400 |
| Flash Point | 120.5ºC |
| Exact Mass | 192.11500 |
| PSA | 26.30000 |
| LogP | 2.92400 |
| Vapour Pressure | 0.00195mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | IJSLNFBUJUTKGK-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(C)(C)C)cc1 |
| HS Code | 2914509090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Propanone,2-dimethyl |
| tert-Butyl 4-methoxyphenyl ketone |
| 4-Methoxyphenyl-tert-butyl ketone |
| 2,2-DIMETHYL-1-PYRIMIDIN-5-YL-PROPAN-1-ONE |
| p-methoxypivalophenone |
| 1-(4-methoxyphenyl)-2,2-dimethyl-1-propanone |
| (CH3)3CO-C6H4-4-OMe |
| 1-(4-METHOXYPHENYL)-2,2-DIMETHYL-PROPAN-1-ONE |
| Propiophenone,2-dimethyl |
| 1-(p-methoxyphenyl)-2,2-dimethyl-1-propanone |