(Z)-N-[2-(2-hydroxyethoxy)ethyl]-9-octadecenamide structure
|
Common Name | (Z)-N-[2-(2-hydroxyethoxy)ethyl]-9-octadecenamide | ||
|---|---|---|---|---|
| CAS Number | 20429-33-8 | Molecular Weight | 369.58200 | |
| Density | 0.935g/cm3 | Boiling Point | 532.2ºC at 760 mmHg | |
| Molecular Formula | C22H43NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.7ºC | |
| Name | (Z)-N-[2-(2-hydroxyethoxy)ethyl]octadec-9-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.935g/cm3 |
|---|---|
| Boiling Point | 532.2ºC at 760 mmHg |
| Molecular Formula | C22H43NO3 |
| Molecular Weight | 369.58200 |
| Flash Point | 275.7ºC |
| Exact Mass | 369.32400 |
| PSA | 62.05000 |
| LogP | 5.98930 |
| Vapour Pressure | 1.5E-13mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | ULHGTPIJYDGNHZ-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCOCCO |
| HS Code | 2924199090 |
|---|
|
~%
(Z)-N-[2-(2-hyd... CAS#:20429-33-8 |
| Literature: Zhang, Hesheng Patent: US2009/325894 A1, 2009 ; Location in patent: Page/Page column 10 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 243-818-5 |
| Oleylamidoethylenoxyethanol |
| Diglycoloelsaeureamid |