2',5'-dichloroacetoacetanilide structure
|
Common Name | 2',5'-dichloroacetoacetanilide | ||
|---|---|---|---|---|
| CAS Number | 2044-72-6 | Molecular Weight | 246.09000 | |
| Density | 1.393g/cm3 | Boiling Point | 410.5ºC at 760 mmHg | |
| Molecular Formula | C10H9Cl2NO2 | Melting Point | 93-97 °C | |
| MSDS | USA | Flash Point | 202ºC | |
| Name | N-(2,5-dichlorophenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 410.5ºC at 760 mmHg |
| Melting Point | 93-97 °C |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09000 |
| Flash Point | 202ºC |
| Exact Mass | 245.00100 |
| PSA | 46.17000 |
| LogP | 2.98400 |
| Vapour Pressure | 6.02E-07mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | HLMZZYYGOKOOTA-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1cc(Cl)ccc1Cl |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S37/39-S26 |
| HS Code | 2924299090 |
|
~%
2',5'-dichloroa... CAS#:2044-72-6 |
| Literature: Helvetica Chimica Acta, , vol. 11, p. 780 |
|
~%
2',5'-dichloroa... CAS#:2044-72-6 |
| Literature: US2152787 , ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00018520 |
| EINECS 218-060-3 |
| 2,4-DICHLOROQUINOLIN-3-CARBOXALDEHYDE |
| 2',5'-Dichloroacetoacetanilide |
| N-Acetoacetyl-2,5-dichloroaniline |
| Acetoacetic acid-2,5-dichloroanilide |
| 2‘,5‘-Dichloroacetoacetanilide |
| 2′,5′-Dichloroacetoacetanilide |