Tris(4-nitrophenyl)amine structure
|
Common Name | Tris(4-nitrophenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 20440-93-1 | Molecular Weight | 380.311 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 594.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H12N4O6 | Melting Point | >300°C | |
| MSDS | Chinese USA | Flash Point | 313.1±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-nitro-N,N-bis(4-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 594.0±45.0 °C at 760 mmHg |
| Melting Point | >300°C |
| Molecular Formula | C18H12N4O6 |
| Molecular Weight | 380.311 |
| Flash Point | 313.1±28.7 °C |
| Exact Mass | 380.075684 |
| PSA | 140.70000 |
| LogP | 6.58 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | LSNJBIDKQIRWRQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N(c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2921499090 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,4',4''-trinitrophenylamine |
| MFCD00024636 |
| Benzenamine, 4-nitro-N,N-bis(4-nitrophenyl)- |
| 4-Nitro-N,N-bis(4-nitrophenyl)aniline |
| 4,4',4'-trinitrotriphenylamine |
| Tris(4-nitrophenyl)amine |
| 4-Nitro-N,N-bis(4-nitrophenyl)benzenamine |