4,4'-dinitrodiphenylamine structure
|
Common Name | 4,4'-dinitrodiphenylamine | ||
|---|---|---|---|---|
| CAS Number | 1821-27-8 | Molecular Weight | 259.21800 | |
| Density | 1.446 g/cm3 | Boiling Point | 464.1ºC at 760 mmHg | |
| Molecular Formula | C12H9N3O4 | Melting Point | 216ºC | |
| MSDS | N/A | Flash Point | 234.4ºC | |
| Name | 4-nitro-N-(4-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446 g/cm3 |
|---|---|
| Boiling Point | 464.1ºC at 760 mmHg |
| Melting Point | 216ºC |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.21800 |
| Flash Point | 234.4ºC |
| Exact Mass | 259.05900 |
| PSA | 103.67000 |
| LogP | 4.36600 |
| Vapour Pressure | 8.63E-09mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | MTWHRQTUBOTQTE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccc([N+](=O)[O-])cc2)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2921499090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-nitro-4'-nitrodiphenylamine |
| Bis(4-nitrophenyl)aMine |
| 4,4'-Dinitrodiphenylamine |
| Bis-(4-nitrophenyl)amine |