1-methylsulfonyloxy-4-nitro-benzene structure
|
Common Name | 1-methylsulfonyloxy-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 20455-07-6 | Molecular Weight | 217.19900 | |
| Density | 1.484g/cm3 | Boiling Point | 391.2ºC at 760 mmHg | |
| Molecular Formula | C7H7NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.4ºC | |
| Name | (4-nitrophenyl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.484g/cm3 |
|---|---|
| Boiling Point | 391.2ºC at 760 mmHg |
| Molecular Formula | C7H7NO5S |
| Molecular Weight | 217.19900 |
| Flash Point | 190.4ºC |
| Exact Mass | 217.00400 |
| PSA | 97.57000 |
| LogP | 2.53720 |
| Vapour Pressure | 5.64E-06mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | FFGGSHSHUKFELB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2906299090 |
|---|
|
~98%
1-methylsulfony... CAS#:20455-07-6 |
| Literature: Noji, Toshiharu; Fujiwara, Hideto; Okano, Kentaro; Tokuyama, Hidetoshi Organic Letters, 2013 , vol. 15, # 8 p. 1946 - 1949 |
|
~%
1-methylsulfony... CAS#:20455-07-6 |
| Literature: Kozuka; Yamaguchi; Tagaki Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 2 p. 573 - 576 |
|
~%
1-methylsulfony... CAS#:20455-07-6 |
| Literature: Schall Journal fuer Praktische Chemie (Leipzig), 1893 , vol. <2> 48, p. 243 |
|
~%
1-methylsulfony... CAS#:20455-07-6 |
| Literature: Kozuka, Seizi; Yamaguchi, Shigeru; Tagaki, Waichiro Chemistry Letters, 1981 , p. 1299 - 1300 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-nitrophenyl mesylate |
| 4-Nitro-1-methansulfonyloxy-benzol |
| 4-Nitrophenyl methanesulfonate |
| p-Methylsulfonyloxynitrobenzene |