1-(4-methoxyphenyl)-N-(3-methylphenyl)methanimine structure
|
Common Name | 1-(4-methoxyphenyl)-N-(3-methylphenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 20534-77-4 | Molecular Weight | 225.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-N-(3-methylphenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15NO |
|---|---|
| Molecular Weight | 225.28600 |
| Exact Mass | 225.11500 |
| PSA | 21.59000 |
| LogP | 3.75420 |
| InChIKey | VAQSEMDBSUISTM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2cccc(C)c2)cc1 |
|
~92%
1-(4-methoxyphe... CAS#:20534-77-4 |
| Literature: Rai, Mangat; Khera, Vandana; Kaul; Sharma Journal of the Indian Chemical Society, 2006 , vol. 83, # 2 p. 208 - 209 |
| 4-methoxybenzalidene-3-methyl aniline |
| Anisal-m-toluidin |
| 4-methoxybenzal-3-toluidine |
| Anisaldehyd-m-tolylimid |