DBCO-PEG12-TCO
Modify Date: 2025-11-28 18:16:34
DBCO-PEG12-TCO structure
|
Common Name | DBCO-PEG12-TCO | ||
|---|---|---|---|---|
| CAS Number | 2055022-06-3 | Molecular Weight | 1028.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C54H81N3O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DBCO-PEG12-TCODBCO-PEG12-TCO cantains a TCO and a DBCO moiety. TCO group can specifically react with terrahydrazine. |
| Name | DBCO-PEG12-TCO |
|---|
| Description | DBCO-PEG12-TCO cantains a TCO and a DBCO moiety. TCO group can specifically react with terrahydrazine. |
|---|---|
| Related Catalog | |
| In Vitro | DBCO reacts with azide functionalized compounds or biomolecules without catalyst to form a stable triazole linkage, which is an ideal alternative to copper intolerant applications. |
| Molecular Formula | C54H81N3O16 |
|---|---|
| Molecular Weight | 1028.23 |
| InChIKey | LREIKQBRBHTOTK-UPHRSURJSA-N |
| SMILES | O=C(CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)OC1CCC=CCCC1)NCCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |