DBCO-Sulfo-Link-biotin
Modify Date: 2025-08-26 20:03:51
DBCO-Sulfo-Link-biotin structure
|
Common Name | DBCO-Sulfo-Link-biotin | ||
|---|---|---|---|---|
| CAS Number | 1363444-70-5 | Molecular Weight | 653.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H35N5O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DBCO-Sulfo-Link-biotinDBCO-Sulfo-Link-biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | DBCO-Sulfo-Link-biotin |
|---|
| Description | DBCO-Sulfo-Link-biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Molecular Formula | C31H35N5O7S2 |
|---|---|
| Molecular Weight | 653.77 |
| InChIKey | XDEWKDCHVSWNBX-MXGHRJRVSA-N |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCC(C(=O)NCCC(=O)N1Cc2ccccc2C#Cc2ccccc21)S(=O)(=O)O |