DDMS structure
|
Common Name | DDMS | ||
|---|---|---|---|---|
| CAS Number | 206052-03-1 | Molecular Weight | 433.200 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H23Br2NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DDMSDDMS (Dibromo-dodecenyl-methylsulfimide) is a selective 20-HETE production inhibitor. DDMS attenuates the vasodilatory response to sodium nitroprusside (SNP)[1]. |
| Name | 12,12-dibromo-N-methylsulfonyldodec-11-enamide |
|---|---|
| Synonym | More Synonyms |
| Description | DDMS (Dibromo-dodecenyl-methylsulfimide) is a selective 20-HETE production inhibitor. DDMS attenuates the vasodilatory response to sodium nitroprusside (SNP)[1]. |
|---|---|
| Related Catalog | |
| Target |
20-HETE[1] |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C13H23Br2NO3S |
| Molecular Weight | 433.200 |
| Exact Mass | 430.976532 |
| PSA | 71.62000 |
| LogP | 4.26 |
| Index of Refraction | 1.533 |
| InChIKey | BDCZFOHEQGRTBW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC(=O)CCCCCCCCCC=C(Br)Br |
| 11-Dodecenamide, 12,12-dibromo-N-(methylsulfonyl)- |
| 12,12-dibromo-N-(methylsulfonyl)dodec-11-enamide |
| 12,12-Dibromo-N-(methylsulfonyl)-11-dodecenamide |