N,N-didemethylchlorpheniramine structure
|
Common Name | N,N-didemethylchlorpheniramine | ||
|---|---|---|---|---|
| CAS Number | 20619-13-0 | Molecular Weight | 246.73500 | |
| Density | 1.166g/cm3 | Boiling Point | 374ºC at 760mmHg | |
| Molecular Formula | C14H15ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | 3-(4-chlorophenyl)-3-pyridin-2-ylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 374ºC at 760mmHg |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.73500 |
| Flash Point | 180ºC |
| Exact Mass | 246.09200 |
| PSA | 38.91000 |
| LogP | 3.91600 |
| Vapour Pressure | 8.6E-06mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | FNBHBFPBGUXPRF-UHFFFAOYSA-N |
| SMILES | NCCC(c1ccc(Cl)cc1)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N-Didemethylchlorpheniramine |
| DDCP |
| Didesmethylchlorpheniramine |