Methyltriphenylphosphonium iodide structure
|
Common Name | Methyltriphenylphosphonium iodide | ||
|---|---|---|---|---|
| CAS Number | 2065-66-9 | Molecular Weight | 404.224 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18IP | Melting Point | 183-185 °C(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | methyl(triphenyl)phosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 183-185 °C(lit.) |
|---|---|
| Molecular Formula | C19H18IP |
| Molecular Weight | 404.224 |
| Exact Mass | 404.019073 |
| PSA | 13.59000 |
| LogP | 0.61430 |
| InChIKey | JNMIXMFEVJHFNY-UHFFFAOYSA-M |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| Water Solubility | SOLUBLE |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R25;R36/37/38 |
| Safety Phrases | S26-S36-S45-S37/39-S28A |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2931900090 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Methyltriphenylphosphonium iodide |
| MFCD00066175 |
| Triphenylmethylphosphonium iodide |
| MeP(1+)PPh3I(1-) |
| methyltriphenyl-phosphonium iodide |
| Triphenylmethylphosphinium iodide |
| Phosphonium, methyltriphenyl-, iodide (1:1) |
| EINECS 218-178-5 |
| [Ph3PCH3](1+)I(1-) |
| Methyl(triphenyl)phosphonium iodide |
| triphenyl-methyl-phosphonium iodide |
| methyl(triphenyl)phosphanium iodide |
| Triphenylmethylphosphine iodide |
| Methyltriphenylphosphoniumiodide |