Chalinasterol structure
|
Common Name | Chalinasterol | ||
|---|---|---|---|---|
| CAS Number | 474-63-5 | Molecular Weight | 398.66400 | |
| Density | 0.98g/cm3 | Boiling Point | 490.3ºC at 760mmHg | |
| Molecular Formula | C28H46O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
Use of Chalinasterol24-Methylenecholesterol (Ostreasterol), a natural marine sterol, stimulates cholesterol acyltransferase in human macrophages. 24-Methylenecholesterol possess anti-aging effects in yeast. 24-methylenecholesterol enhances honey bee longevity and improves nurse bee physiology[1][2][3]. |
| Name | 24-methylenecholesterol |
|---|---|
| Synonym | More Synonyms |
| Description | 24-Methylenecholesterol (Ostreasterol), a natural marine sterol, stimulates cholesterol acyltransferase in human macrophages. 24-Methylenecholesterol possess anti-aging effects in yeast. 24-methylenecholesterol enhances honey bee longevity and improves nurse bee physiology[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 490.3ºC at 760mmHg |
| Molecular Formula | C28H46O |
| Molecular Weight | 398.66400 |
| Flash Point | 213.8ºC |
| Exact Mass | 398.35500 |
| PSA | 20.23000 |
| LogP | 7.55480 |
| Vapour Pressure | 1.14E-11mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | INDVLXYUCBVVKW-PXBBAZSNSA-N |
| SMILES | C=C(CCC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| 24-methylencholesterol |
| Chalinasterol |