6',7'-Epoxybergamottin (Epoxybergamottin) structure
|
Common Name | 6',7'-Epoxybergamottin (Epoxybergamottin) | ||
|---|---|---|---|---|
| CAS Number | 206978-14-5 | Molecular Weight | 354.39600 | |
| Density | 1.210 | Boiling Point | N/A | |
| Molecular Formula | C21H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 6',7'-Epoxybergamottin (Epoxybergamottin)6',7'-Epoxybergamottin is a metabolism of Penicillium digitatum. 6',7'-Epoxybergamottin can be used in study the cytochrome P450 3A4 inhibitory activity[1]. |
| Name | Epoxybergamottin |
|---|
| Description | 6',7'-Epoxybergamottin is a metabolism of Penicillium digitatum. 6',7'-Epoxybergamottin can be used in study the cytochrome P450 3A4 inhibitory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.210 |
|---|---|
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.39600 |
| Exact Mass | 354.14700 |
| PSA | 65.11000 |
| LogP | 4.82190 |
| InChIKey | OOKSPQLCQUBEKU-MDWZMJQESA-N |
| SMILES | CC(=CCOc1c2ccoc2cc2oc(=O)ccc12)CCC1OC1(C)C |
| Storage condition | ?20°C |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |