CARM1 inhibitor 1 hydrochloride structure
|
Common Name | CARM1 inhibitor 1 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2070018-31-2 | Molecular Weight | 591.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22Br2ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CARM1 inhibitor 1 hydrochlorideCARM1 inhibitor 1 hydrochloride is a potent and specific inhibitor of CARM1 (Coactivator-associated arginine methyltransferase 1), with an IC50 of 8.6 μM. CARM1 inhibitor 1 hydrochloride exhibits weak |
| Name | CARM1-IN-1 (hydrochloride) |
|---|
| Molecular Formula | C26H22Br2ClNO3 |
|---|---|
| Molecular Weight | 591.72 |
| InChIKey | QLPNYHLFFVKOAN-CUBOLJEZSA-N |
| SMILES | Cl.O=C1C(=Cc2ccc(O)c(Br)c2)CN(Cc2ccccc2)CC1=Cc1ccc(O)c(Br)c1 |