tert-Butyl endo-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate structure
|
Common Name | tert-Butyl endo-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 207405-68-3 | Molecular Weight | 240.342 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 333.8±31.0 °C at 760 mmHg | |
| Molecular Formula | C13H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.7±24.8 °C | |
| Name | N-Boc-endo-3-aminotropane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.8±31.0 °C at 760 mmHg |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.342 |
| Flash Point | 155.7±24.8 °C |
| Exact Mass | 240.183777 |
| PSA | 55.56000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | NZJKEPNCNBWESN-PBINXNQUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(N)C2 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~71%
tert-Butyl endo... CAS#:207405-68-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 51, # 20 p. 6538 - 6546 |
|
~69%
tert-Butyl endo... CAS#:207405-68-3 |
| Literature: US2006/100426 A1, ; Page/Page column 18-19 ; US 20060100426 A1 |
|
~%
tert-Butyl endo... CAS#:207405-68-3 |
| Literature: US2006/199839 A1, ; Page/Page column 23-24 ; US 20060199839 A1 |
|
~%
tert-Butyl endo... CAS#:207405-68-3 |
| Literature: US5968929 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Carbamic acid, N-(8-methyl-8-azabicyclo[3.2.1]oct-3-yl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate |
| 8-Azabicyclo[3.2.1]octane-8-carboxylic acid, 3-amino-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl (8-methyl-8-azabicyclo[3.2.1]oct-3-yl)carbamate |
| endo-3-Amino-8-Boc-8-azab... |
| N-Boc-endo-3-Aminotropane |