3,3'-Dibromo-5,5'-bis-trimethylsilyl-2,2'-bithiophene structure
|
Common Name | 3,3'-Dibromo-5,5'-bis-trimethylsilyl-2,2'-bithiophene | ||
|---|---|---|---|---|
| CAS Number | 207742-50-5 | Molecular Weight | 468.418 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 400.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H20Br2S2Si2 | Melting Point | 89 °C | |
| MSDS | USA | Flash Point | 196.2±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [4-bromo-5-(3-bromo-5-trimethylsilylthiophen-2-yl)thiophen-2-yl]-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.8±45.0 °C at 760 mmHg |
| Melting Point | 89 °C |
| Molecular Formula | C14H20Br2S2Si2 |
| Molecular Weight | 468.418 |
| Flash Point | 196.2±28.7 °C |
| Exact Mass | 465.891144 |
| PSA | 56.48000 |
| LogP | 9.63 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | ZKCVPMCCGPMMBH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1cc(Br)c(-c2sc([Si](C)(C)C)cc2Br)s1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
|
~86%
3,3'-Dibromo-5,... CAS#:207742-50-5 |
| Literature: Organic Letters, , vol. 12, # 9 p. 2136 - 2139 |
|
~94%
3,3'-Dibromo-5,... CAS#:207742-50-5 |
| Literature: US8436208 B2, ; Page/Page column 38 ; |
|
~80%
3,3'-Dibromo-5,... CAS#:207742-50-5 |
| Literature: Organic and Biomolecular Chemistry, , vol. 12, # 15 p. 2474 - 2478 |
|
~72%
3,3'-Dibromo-5,... CAS#:207742-50-5 |
| Literature: WO2008/109701 A1, ; Page/Page column 26 ; |
|
~69%
3,3'-Dibromo-5,... CAS#:207742-50-5 |
| Literature: US2011/132460 A1, ; |
|
~%
3,3'-Dibromo-5,... CAS#:207742-50-5 |
| Literature: Journal of Nanoscience and Nanotechnology, , vol. 12, # 5 p. 4279 - 4283 |
|
~%
3,3'-Dibromo-5,... CAS#:207742-50-5 |
| Literature: Organic Letters, , vol. 15, # 18 p. 4642 - 4645 |
|
~%
3,3'-Dibromo-5,... CAS#:207742-50-5 |
| Literature: Macromolecules, , vol. 43, # 2 p. 697 - 708 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Chen, C. H.; Hsieh, C. H.; Dubosc, M.; Cheng, Y. J.; Hsu, C. S.
Macromolecules 43 , 697, (2010)
|
| 3,3'-dibromo-5,5'-bis-trimethylsilanyl-2,2'-bithiophene |
| (3,3'-Dibromo-2,2'-bithiene-5,5'-diyl)bis(trimethylsilane) |
| 5,5'-bis(trimethylsilyl)-3,3'-dibromo,-2,2'-bithiophene |
| Silane, 1,1'-(3,3'-dibromo[2,2'-bithiophene]-5,5'-diyl)bis[1,1,1-trimethyl- |
| 3,3'-dibromo-5,5'-bis(trimethylsilyl)-2,2'-dithiophene |
| 3,3'-Dibromo-5,5'-bis(trimethylsilyl)-2,2'-bithiophene |
| (3,3'-Dibromo-[2,2'-bithiophene]-5,5'-diyl)bis(trimethylsilane) |
| 3,3-Dibromo-5,5-bis(trimethylsilyl)-2,2-bithiophene |
| 3,3'-Dibromo-5,5'-bis-trimethylsilyl-2,2'-bithiophene |