GSK3839919A structure
|
Common Name | GSK3839919A | ||
|---|---|---|---|---|
| CAS Number | 2081127-77-5 | Molecular Weight | 604.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H46ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GSK3839919AGSK3839919A is a potent and allosteric HIV-1integrase inhibitor[1]. |
| Name | GSK3839919A |
|---|
| Description | GSK3839919A is a potent and allosteric HIV-1integrase inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C36H46ClN3O3 |
|---|---|
| Molecular Weight | 604.22 |
| InChIKey | KETKYQCQNXUIQX-XIFFEERXSA-N |
| SMILES | Cc1cccc(Cl)c1CN1CCc2cc(-c3cnc(C)c(C(OC(C)(C)C)C(=O)O)c3N3CCC(C)(C)CC3)ccc2C1 |