5-Methoxy-2-nitrobenzeneacetic acid structure
|
Common Name | 5-Methoxy-2-nitrobenzeneacetic acid | ||
|---|---|---|---|---|
| CAS Number | 20876-29-3 | Molecular Weight | 211.171 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 404.7±30.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5±24.6 °C | |
| Name | 2-(5-methoxy-2-nitrophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 404.7±30.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.171 |
| Flash Point | 198.5±24.6 °C |
| Exact Mass | 211.048065 |
| PSA | 92.35000 |
| LogP | 1.32 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | QBRHCFNZQWZEQM-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(CC(=O)O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~66%
5-Methoxy-2-nit... CAS#:20876-29-3 |
| Literature: Journal of Organic Chemistry, , vol. 66, # 25 p. 8447 - 8453 |
|
~%
5-Methoxy-2-nit... CAS#:20876-29-3 |
| Literature: Tetrahedron, , vol. 24, p. 6093 - 6109 |
|
~%
5-Methoxy-2-nit... CAS#:20876-29-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 18, # 4 p. 1482 - 1496 |
|
~%
5-Methoxy-2-nit... CAS#:20876-29-3 |
| Literature: Archiv der Pharmazie, , vol. 321, # 5 p. 265 - 272 |
|
~%
5-Methoxy-2-nit... CAS#:20876-29-3 |
| Literature: Journal of the Chemical Society, , vol. 125, p. 313 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Nitro-5-methoxy-phenylessigsaeure |
| 5-methoxy-2-nitrophenyl-acetic acid |
| 5-methoxy-2-nitrobenzene-acetic acid |
| 5-Methoxy-2-nitrophenyl acetic acid |
| Benzeneacetic acid, 5-methoxy-2-nitro- |
| (5-Methoxy-2-nitro-phenyl)-essigsaeure |
| Benzeneaceticacid,5-methoxy-2-nitro |
| (5-Methoxy-2-nitrophenyl)acetic acid |