Methyl 3,4-bis(bromomethyl)benzoate structure
|
Common Name | Methyl 3,4-bis(bromomethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 20896-23-5 | Molecular Weight | 321.993 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 369.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H10Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.3±27.9 °C | |
| Name | methyl 3,4-bis(bromomethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.5±42.0 °C at 760 mmHg |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 321.993 |
| Flash Point | 177.3±27.9 °C |
| Exact Mass | 319.904755 |
| PSA | 26.30000 |
| LogP | 3.68 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | PZOQMRZOUBBQFO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(CBr)c(CBr)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S36/S37/S39 |
| HS Code | 2916399090 |
|
~84%
Methyl 3,4-bis(... CAS#:20896-23-5 |
| Literature: Hou, Duen-Ren; Wang, Ming-Shiang; Chung, Ming-Wen; Hsieh, Yih-Dar; Tsai, Hui-Hsu Gavin Journal of Organic Chemistry, 2007 , vol. 72, # 24 p. 9231 - 9239 |
|
~%
Methyl 3,4-bis(... CAS#:20896-23-5 |
| Literature: US5026856 A1, ; |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00219865 |
| Benzoic acid, 3,4-bis(bromomethyl)-, methyl ester |
| 3,4-bisbromomethylbenzoic acid methyl ester |
| Methyl 3,4-bis(bromomethyl)benzoate |
| methyl 3,4-dibromomethylbenzoate |