1-Adamantanecarboxamide structure
|
Common Name | 1-Adamantanecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 5511-18-2 | Molecular Weight | 179.259 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 343.3±9.0 °C at 760 mmHg | |
| Molecular Formula | C11H17NO | Melting Point | 188-190 °C(lit.) | |
| MSDS | USA | Flash Point | 161.4±18.7 °C | |
| Name | 1-adamantanecarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.3±9.0 °C at 760 mmHg |
| Melting Point | 188-190 °C(lit.) |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.259 |
| Flash Point | 161.4±18.7 °C |
| Exact Mass | 179.131012 |
| PSA | 43.09000 |
| LogP | 1.65 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | CKBZJTAMRPPVSR-UHFFFAOYSA-N |
| SMILES | NC(=O)C12CC3CC(CC(C3)C1)C2 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
[Comparative study of the mechanism of inhibition of Sindbis virus reproduction by adamantane derivatives: remantadine and amide of 1-adamantane carboxylic acid].
Antibiot. Khimioter. 41(7-8) , 26-30, (1996) Amide of 1-adamantane carboxylic acid (AACA), the same as remantadine, was shown to have no antiviral action and any influence on the efficiency of the Sindbis virus adsorption. However, it significan... |
|
|
Capture of a single molecule in a nanocavity.
Science 291(5504) , 636-40, (2001) We describe a heptameric protein pore that has been engineered to accommodate two different cyclodextrin adapters simultaneously within the lumen of a transmembrane beta barrel. The volume between the... |
| Adamantane-1-carboxamide |
| MFCD00077200 |
| 1-Adamantanecarboxamide |
| EINECS 234-074-2 |
| Tricyclo[3.3.1.1]decane-1-carboxamide |