N,N-bis(2-phenylphenyl)oxamide structure
|
Common Name | N,N-bis(2-phenylphenyl)oxamide | ||
|---|---|---|---|---|
| CAS Number | 21022-17-3 | Molecular Weight | 392.44900 | |
| Density | 1.249g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H20N2O2 | Melting Point | 241 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-bis(2-phenylphenyl)oxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Melting Point | 241 °C |
| Molecular Formula | C26H20N2O2 |
| Molecular Weight | 392.44900 |
| Exact Mass | 392.15200 |
| PSA | 58.20000 |
| LogP | 5.74380 |
| Index of Refraction | 1.681 |
| InChIKey | VKRWRNVGVPSVLA-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)C(=O)Nc1ccccc1-c1ccccc1 |
| Hazard Codes | N |
|---|
|
~%
N,N-bis(2-pheny... CAS#:21022-17-3 |
| Literature: Ciba Ltd. Patent: FR1506632 , 1967 ; Chem.Abstr., 1969 , vol. 70, # 19823 |
|
~%
N,N-bis(2-pheny... CAS#:21022-17-3 |
| Literature: Walls Journal of the Chemical Society, 1934 , p. 104,106 Journal of the Chemical Society, 1935 , p. 1405,1406 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N.N'-Bis-(biphenylyl-(2))-oxamid |
| N,N'-bis-biphenyl-2-yl-oxalamide |