4-(4-Bromophenyl)-2-thiazolethiol structure
|
Common Name | 4-(4-Bromophenyl)-2-thiazolethiol | ||
|---|---|---|---|---|
| CAS Number | 2103-95-9 | Molecular Weight | 272.18500 | |
| Density | 1.768g/cm3 | Boiling Point | 376.2ºC at 760 mmHg | |
| Molecular Formula | C9H6BrNS2 | Melting Point | 220-224ºC | |
| MSDS | Chinese USA | Flash Point | 181.32ºC | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 4-(4-bromophenyl)-3H-1,3-thiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.768g/cm3 |
|---|---|
| Boiling Point | 376.2ºC at 760 mmHg |
| Melting Point | 220-224ºC |
| Molecular Formula | C9H6BrNS2 |
| Molecular Weight | 272.18500 |
| Flash Point | 181.32ºC |
| Exact Mass | 270.91300 |
| PSA | 79.93000 |
| LogP | 3.86130 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.783 |
| InChIKey | QNNMMIMBOFCDQK-UHFFFAOYSA-N |
| SMILES | S=c1[nH]c(-c2ccc(Br)cc2)cs1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-37/38-41 |
| Safety Phrases | 26-39 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Name: Inhibition of human IDO1 at 10 uM pre-incubated for 10 mins before L-Trp as substrate...
Source: ChEMBL
Target: Indoleamine 2,3-dioxygenase 1
External Id: CHEMBL4056588
|
|
Name: Inhibition of human IDO1 at 100 uM pre-incubated for 10 mins before L-Trp as substrat...
Source: ChEMBL
Target: Indoleamine 2,3-dioxygenase 1
External Id: CHEMBL4056587
|
| 4-(p-Bromophenyl)-2-mercaptothiazole |
| 2-Mercapto-4-(p-bromophenyl)thiazole |
| 4-(4'-bromophenyl)-2-mercaptothiazole |
| 4-(4-Bromophenyl)-2-thiazolethiol |
| 4-(4-BROMOPHENYL)-1,3-THIAZOLE-2-THIOL |
| 4-(4-Bromophenyl)-2(3H)-thiazolethione |
| 2-mercapto-4-(4-bromophenyl)thiazole |
| 4-(4-bromo-phenyl)-3H-thiazole-2-thione |
| 2-Thiazolethiol,4-(p-bromophenyl)-(7CI,8CI) |