H-Glu-Ala-OH structure
|
Common Name | H-Glu-Ala-OH | ||
|---|---|---|---|---|
| CAS Number | 21064-18-6 | Molecular Weight | 218.20700 | |
| Density | 1.362 g/cm3 | Boiling Point | 566.5ºC at 760 mmHg | |
| Molecular Formula | C8H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.4ºC | |
| Name | 4-amino-5-(1-carboxyethylamino)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362 g/cm3 |
|---|---|
| Boiling Point | 566.5ºC at 760 mmHg |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.20700 |
| Flash Point | 296.4ºC |
| Exact Mass | 218.09000 |
| PSA | 129.72000 |
| Vapour Pressure | 2.59E-14mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | JZDHUJAFXGNDSB-WHFBIAKZSA-N |
| SMILES | CC(NC(=O)C(N)CCC(=O)O)C(=O)O |
| HS Code | 2924199090 |
|---|
|
~%
H-Glu-Ala-OH CAS#:21064-18-6 |
| Literature: Sachs; Brand Journal of the American Chemical Society, 1953 , vol. 75, p. 4608 |
|
~%
H-Glu-Ala-OH CAS#:21064-18-6 |
| Literature: Sachs; Brand Journal of the American Chemical Society, 1954 , vol. 76, p. 1815 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| a-L-Glutamyl-L-alanine |
| H-Glu-Ala-OH |
| Glu-ala |
| L-Glutamyl-L-alanine |
| L-Glu-L-Ala |
| glutamyl-alanine |
| a-Glutamylalanine |