Glycine,N-[(phenylmethoxy)carbonyl]-, 2-[(4-methylphenyl)sulfonyl]ethyl ester structure
|
Common Name | Glycine,N-[(phenylmethoxy)carbonyl]-, 2-[(4-methylphenyl)sulfonyl]ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21079-01-6 | Molecular Weight | 391.43800 | |
| Density | 1.277g/cm3 | Boiling Point | 617ºC at 760 mmHg | |
| Molecular Formula | C19H21NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326.9ºC | |
| Name | 2-(4-methylphenyl)sulfonylethyl 2-(phenylmethoxycarbonylamino)acetate |
|---|
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 617ºC at 760 mmHg |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.43800 |
| Flash Point | 326.9ºC |
| Exact Mass | 391.10900 |
| PSA | 107.15000 |
| LogP | 3.71000 |
| Vapour Pressure | 3.74E-15mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | SHAYSIPWSQCYDG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CCOC(=O)CNC(=O)OCc2ccccc2)cc1 |
|
~%
Glycine,N-[(phe... CAS#:21079-01-6 |
| Literature: Miller; Stirling Journal of the Chemical Society. Perkin transactions 1, 1968 , vol. 21, p. 2612 - 2617 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |