Propanedioicacid, 2-(1,1-dimethyl-2-propyn-1-yl)-, 1,3-diethyl ester structure
|
Common Name | Propanedioicacid, 2-(1,1-dimethyl-2-propyn-1-yl)-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21079-27-6 | Molecular Weight | 226.26900 | |
| Density | 1.039g/cm3 | Boiling Point | 284.2ºC at 760mmHg | |
| Molecular Formula | C12H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.1ºC | |
| Name | diethyl 2-(2-methylbut-3-yn-2-yl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.039g/cm3 |
|---|---|
| Boiling Point | 284.2ºC at 760mmHg |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.26900 |
| Flash Point | 131.1ºC |
| Exact Mass | 226.12100 |
| PSA | 52.60000 |
| LogP | 1.38820 |
| Vapour Pressure | 0.00303mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | GNCXYZOCHNPJEF-UHFFFAOYSA-N |
| SMILES | C#CC(C)(C)C(C(=O)OCC)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 7 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| ethyl 3,3-dimethyl-2-ethoxycarbonylpent-4-ynoate |