diethyl 2-(2-methylbut-3-en-2-yl)propanedioate
diethyl 2-(2-methylbut-3-en-2-yl)propanedioate structure
|
Common Name | diethyl 2-(2-methylbut-3-en-2-yl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 758-66-7 | Molecular Weight | 228.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Diethyl 2-(2-methylbut-3-en-2-yl)propanedioate (CAS: 758-66-7), molecular formula C12H20O4, molecular weight 228.28500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2-(2-methylbut-3-en-2-yl)propanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20O4 |
|---|---|
| Molecular Weight | 228.28500 |
| Exact Mass | 228.13600 |
| PSA | 52.60000 |
| LogP | 1.94100 |
| InChIKey | QMJRNFWBXIXUGR-UHFFFAOYSA-N |
| SMILES | C=CC(C)(C)C(C(=O)OCC)C(=O)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 3 | |
CAS#:21079-27-6
CAS#:24509-88-4
CAS#:105-53-3
CAS#:40426-44-6
CAS#:118068-94-3
CAS#:14309-15-0
CAS#:1191-16-8
CAS#:996-82-7
CAS#:15543-64-3
CAS#:30458-07-2
CAS#:7796-73-8
CAS#:87110-26-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2-dimethyl-3-butene-1,1-dicarboxylic acid diethyl ester |
| ethyl 3,3-dimethyl-2-ethoxycarbonylpent-4-enoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate? |
| A: CAS number of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate is 758-66-7. |
| Q: What are the upstream materials of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate? |
| A: Related upstream materials(CAS) of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate: 21079-27-6;24509-88-4;105-53-3;40426-44-6;118068-94-3;14309-15-0;1191-16-8;996-82-7;15543-64-3. |
| Q: What is the polar surface area (PSA) of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate? |
| A: Polar surface area (PSA) of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate is 52.60000. |
| Q: What is the LogP of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate? |
| A: LogP of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate is 1.94100. |
| Q: What is the Chinese name of 758-66-7? |
| A: Chinese name of 758-66-7 is 758-66-7. |
| Q: What is the SMILES notation of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate? |
| A: SMILES notation of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate is C=CC(C)(C)C(C(=O)OCC)C(=O)OCC. |
| Q: What is the English name of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate? |
| A: The English name of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate is diethyl 2-(2-methylbut-3-en-2-yl)propanedioate. |
| Q: What is the InChIKey of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate? |
| A: InChIKey of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate is QMJRNFWBXIXUGR-UHFFFAOYSA-N. |
| Q: What is the molecular weight of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate? |
| A: Molecular weight of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate is 228.28500. |
| Q: What is the molecular formula of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate? |
| A: Molecular formula of diethyl 2-(2-methylbut-3-en-2-yl)propanedioate is C12H20O4. |