Metribuzin structure
|
Common Name | Metribuzin | ||
|---|---|---|---|---|
| CAS Number | 21087-64-9 | Molecular Weight | 214.288 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 312.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C8H14N4OS | Melting Point | 125°C | |
| MSDS | USA | Flash Point | 142.7±23.2 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
Use of MetribuzinMetribuzin is a low-cost non-selective herbicide that belongs to the chemical class of triazinones. Metribuzin hinders DNA synthesis in treated plants and acts on photosystem II, ultimately inhibiting photosynthesis. Metribuzin provides good control of important annual grass and broad-leaf weeds[1]. |
| Name | metribuzin |
|---|---|
| Synonym | More Synonyms |
| Description | Metribuzin is a low-cost non-selective herbicide that belongs to the chemical class of triazinones. Metribuzin hinders DNA synthesis in treated plants and acts on photosystem II, ultimately inhibiting photosynthesis. Metribuzin provides good control of important annual grass and broad-leaf weeds[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 312.4±25.0 °C at 760 mmHg |
| Melting Point | 125°C |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.288 |
| Flash Point | 142.7±23.2 °C |
| Exact Mass | 214.088837 |
| PSA | 99.10000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | FOXFZRUHNHCZPX-UHFFFAOYSA-N |
| SMILES | CSc1nnc(C(C)(C)C)c(=O)n1N |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302-H302 + H312 + H332-H312-H319-H332 |
| Precautionary Statements | P210-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22;R50/53 |
| Safety Phrases | 2-60-61-36-26-16 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | XZ2990000 |
| HS Code | 2933699014 |
|
~95%
Metribuzin CAS#:21087-64-9 |
| Literature: Bayer Aktiengesellschaft Patent: US4544744 A1, 1985 ; |
|
~%
Metribuzin CAS#:21087-64-9 |
| Literature: US4309538 A1, ; |
|
~%
Metribuzin CAS#:21087-64-9 |
| Literature: US2003/216573 A1, ; Page/Page column 4 ; |
|
~%
Metribuzin CAS#:21087-64-9 |
| Literature: US4309538 A1, ; |
| HS Code | 2933699014 |
|---|---|
| Summary | 2933699014 4-amino-6-(tert-butyl)-3-(methylthio)-1,2,4-triazin-5(4h)-one。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
Quantification of triazine herbicides in soil by microwave-assisted extraction and high-performance liquid chromatography.
Environ. Monit. Assess. 178(1-4) , 111-9, (2011) A method for the determination of herbicides residues, triazine (atrazine, metribuzin, ametryn, and terbutryn), in soil samples with high-performance liquid chromatography (HPLC)-UV detection is descr... |
|
|
Controlled release formulations of metribuzin: release kinetics in water and soil.
J. Environ. Sci. Health B 45 , 330-335, (2010) Controlled release (CR) formulations of metribuzin in Polyvinyl chloride [(PVC) (emulsion)], carboxy methyl cellulose (CMC), and carboxy methyl cellulose-kaolinite composite (CMC-KAO), are reported. K... |
|
|
Reduced downward mobility of metribuzin in fly ash-amended soils.
J. Environ. Sci. Health B 48(7) , 587-92, (2013) Metribuzin, a triazine herbicide, is poorly sorbed in the soils, therefore leaches to lower soil profile. Fly ash amendment, which enhanced metribuzin sorption in soils, may play a significant role in... |
| 4-amino-6-tert-butyl-4,5-dihydro-3-methylthio-1,2,4-triazin-5-one |
| Lexone DF |
| Sencorer |
| Sencoral |
| Sencorex |
| 1,2,4-triazinone |
| MFCD00055525 |
| Sengoral |
| 4-amino-6-(1,1-dimethylethyl)-3-(methylthio)-1,2,4-triazin-5(4H)-one |
| 4-amino-6-tert-butyl-3-(methylsulfanyl)-1,2,4-triazin-5(4H)-one |
| 4-amino-6-tert-butyl-3-methylsulfanyl-1,2,4-triazin-5-one |
| Sencor 75DF |
| 4-Amino-6-(2-methyl-2-propanyl)-3-(methylsulfanyl)-1,2,4-triazin-5(4H)-one |
| BAY 6159H |
| 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one |
| Sencor DF |
| Sencor 4 |
| 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5-one |
| EINECS 244-209-7 |
| Sencor |
| Lexone |
| Metribuzine |
| 4-Amino-6-tert-butyl-3-(methylsulfanyl)-1,2,4-triazin-5(4H)-on |
| Metribuzin |
| Senkor |
| Zenkor |
| Sencorex L.F. |