DADK structure
|
Common Name | DADK | ||
|---|---|---|---|---|
| CAS Number | 52236-30-3 | Molecular Weight | 169.181 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-tert-butyl-2H-1,2,4-triazine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.181 |
| Exact Mass | 169.085129 |
| PSA | 78.61000 |
| LogP | 0.92 |
| Index of Refraction | 1.588 |
| InChIKey | ZARIFGFXSIZTAK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1n[nH]c(=O)[nH]c1=O |
| Storage condition | 0-6°C |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 6-(2-Methyl-2-propanyl)-1,2,4-triazine-3,5(2H,4H)-dione |
| 6-(2-Méthyl-2-propanyl)-1,2,4-triazine-3,5(2H,4H)-dione |
| 6-(tert-butyl)-2H,4H-1,2,4-triazine-3,5-dione |
| 1,2,4-Triazine-3,5(2H,4H)-dione,6-(1,1-dimethylethyl) |
| Metribuzin deaminated diketo metabolite |
| 6-(2-Methyl-2-propanyl)-1,2,4-triazin-3,5(2H,4H)-dion |
| Metribuzin DADK |
| 1,2,4-Triazine-3,5(2H,4H)-dione, 6-(1,1-dimethylethyl)- |
| DADK |
| 6-tert-Butyl-1,2,4-triazine-3,5(2H,4H)-dione |
| Sencor deaminated diketo metabolite |
| 6-tert-Butyl-3,5-dihydroxy-1,2,4-triazine |