2-(3-Phenyl-2-propenylidene)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-3(2H)-one structure
|
Common Name | 2-(3-Phenyl-2-propenylidene)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-3(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 21108-76-9 | Molecular Weight | 256.32300 | |
| Density | 1.28g/cm3 | Boiling Point | 423.3ºC at 760 mmHg | |
| Molecular Formula | C14H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.8ºC | |
| Name | (2E)-2-[(E)-3-phenylprop-2-enylidene]-5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 423.3ºC at 760 mmHg |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.32300 |
| Flash Point | 209.8ºC |
| Exact Mass | 256.06700 |
| PSA | 62.60000 |
| LogP | 0.47250 |
| Vapour Pressure | 2.25E-07mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | XHLPINSEHAYUJB-JHLWKMQHSA-N |
| SMILES | O=c1c(=CC=Cc2ccccc2)sc2n1CCN=2 |
|
~%
2-(3-Phenyl-2-p... CAS#:21108-76-9 |
| Literature: Chaudhari,H.S.; Pujari,H.K. Journal of the Indian Chemical Society, 1968 , vol. 45, p. 710 - 713 |
|
~%
2-(3-Phenyl-2-p... CAS#:21108-76-9 |
| Literature: Limar Farm. Z.Chem.Abstr., 1959 , vol. 14, # 6 p. 12 Farm. Z.Chem.Abstr., 1960 , p. 22573 |
| 2-trans-Cinnamylamino-aethanol |
| 2-trans-cinnamylamino-ethanol |