tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate structure
|
Common Name | tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 211108-50-8 | Molecular Weight | 217.237 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 288.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H16FNO3 | Melting Point | 77 °C | |
| MSDS | Chinese USA | Flash Point | 128.4±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl 3-fluoro-4-oxopiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.7±40.0 °C at 760 mmHg |
| Melting Point | 77 °C |
| Molecular Formula | C10H16FNO3 |
| Molecular Weight | 217.237 |
| Flash Point | 128.4±27.3 °C |
| Exact Mass | 217.111420 |
| PSA | 46.61000 |
| LogP | 0.48 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | JZNWQLLPLOQGOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(F)C1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
|
~10%
tert-Butyl 3-fl... CAS#:211108-50-8 |
| Literature: ARRAY BIOPHARMA INC. Patent: WO2008/124323 A1, 2008 ; Location in patent: Page/Page column 40 ; WO 2008/124323 A1 |
|
~%
tert-Butyl 3-fl... CAS#:211108-50-8 |
| Literature: WO2004/5256 A2, ; Page 28 ; WO 2004/005256 A2 |
|
~%
tert-Butyl 3-fl... CAS#:211108-50-8 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 23 p. 5229 - 5223 |
|
~%
tert-Butyl 3-fl... CAS#:211108-50-8 |
| Literature: WO2004/2490 A2, ; Page/Page column 27 ; |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| tert-butyl-3-fluoro-4-oxopiperidine-1-carboxylate |
| 1-Boc-3-fluoro-4-piperidone |
| 1-Piperidinecarboxylic acid, 3-fluoro-4-oxo-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 3-fluoro-4-oxo-1-piperidinecarboxylate |
| 1,1-Dimethylethyl 3-fluoro-4-oxo-1-piperidinecarboxylate |
| tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate |
| 1-Boc-3-fluoropiperidin-4-one |
| 3-fluoro-4-oxo-piperidine-1-carboxylic acid tert-butyl ester |
| tert-butyl 1-(4-oxo-3-fluoropiperidin-1-yl)carboxylate |
| 1-(tert-Butoxycarbonyl)-3-fluoro-4-oxopiperidine |
| T6N DVTJ AVOX1&1&1 CF |
| 1-Boc-3-fluoro-4-oxopiperidine |
| 1-(tert-butoxycarbonyl)-3-fluoro-4-piperidone |