4-(4-chlorophenoxy)benzoic acid structure
|
Common Name | 4-(4-chlorophenoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 21120-67-2 | Molecular Weight | 248.66200 | |
| Density | 1.347g/cm3 | Boiling Point | 392.3ºC at 760mmHg | |
| Molecular Formula | C13H9ClO3 | Melting Point | 167-171ºC | |
| MSDS | Chinese USA | Flash Point | 191.1ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 4-(4-chlorophenoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 392.3ºC at 760mmHg |
| Melting Point | 167-171ºC |
| Molecular Formula | C13H9ClO3 |
| Molecular Weight | 248.66200 |
| Flash Point | 191.1ºC |
| Exact Mass | 248.02400 |
| PSA | 46.53000 |
| LogP | 3.83050 |
| Vapour Pressure | 7.39E-07mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | YVVCMTFJWOYNJW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H319-H400 |
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R22 |
| Safety Phrases | 26-36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4PBD-Q02-0 |
| 4'-Carboxy-4-chlor-diphenyl-aether |