Mal-amido-PEG2-Val-Cit-PAB-PNP
Modify Date: 2025-08-27 14:33:39
Mal-amido-PEG2-Val-Cit-PAB-PNP structure
|
Common Name | Mal-amido-PEG2-Val-Cit-PAB-PNP | ||
|---|---|---|---|---|
| CAS Number | 2112738-13-1 | Molecular Weight | 854.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H50N8O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-amido-PEG2-Val-Cit-PAB-PNPMal-amido-PEG2-Val-Cit-PAB-PNP is a cleavable 2 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Mal-amido-PEG2-Val-Cit-PAB-PNP |
|---|
| Description | Mal-amido-PEG2-Val-Cit-PAB-PNP is a cleavable 2 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C39H50N8O14 |
|---|---|
| Molecular Weight | 854.86 |
| InChIKey | PAGAOQLHMRBQFV-QGRQJHSQSA-N |
| SMILES | CC(C)C(NC(=O)CCOCCOCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |