1 4-BIS(2-ETHYLHEXYL)-2 5-DI-1-PROPYNYL& structure
|
Common Name | 1 4-BIS(2-ETHYLHEXYL)-2 5-DI-1-PROPYNYL& | ||
|---|---|---|---|---|
| CAS Number | 211809-67-5 | Molecular Weight | 378.63300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H42 | Melting Point | 66-67ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,4-bis(2-ethylhexyl)-2,5-bis(prop-1-ynyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 66-67ºC(lit.) |
|---|---|
| Molecular Formula | C28H42 |
| Molecular Weight | 378.63300 |
| Exact Mass | 378.32900 |
| LogP | 7.94720 |
| InChIKey | CWDFKLNDSGZYPM-UHFFFAOYSA-N |
| SMILES | CC#Cc1cc(CC(CC)CCCC)c(C#CC)cc1CC(CC)CCCC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2902909090 |
|
~%
1 4-BIS(2-ETHYL... CAS#:211809-67-5 |
| Literature: Kloppenburg; Song; Bunz Journal of the American Chemical Society, 1998 , vol. 120, # 31 p. 7973 - 7974 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| MFCD06411322 |
| 2,5-bis(2-ethylhexyl)-1,4-dipropynylbenzene |
| 1,4-Bis(2-ethylhexyl)-2,5-di-1-propynylbenzene |