1,4-Bis(2-ethylhexyl)-2,5-diiodobenzene structure
|
Common Name | 1,4-Bis(2-ethylhexyl)-2,5-diiodobenzene | ||
|---|---|---|---|---|
| CAS Number | 225512-46-9 | Molecular Weight | 554.33000 | |
| Density | 1.3991 g/mL at 25ºC(lit.) | Boiling Point | 494.3ºC at 760 mmHg | |
| Molecular Formula | C22H36I2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 1,4-Bis(2-ethylhexyl)-2,5-diiodobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3991 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 494.3ºC at 760 mmHg |
| Molecular Formula | C22H36I2 |
| Molecular Weight | 554.33000 |
| Flash Point | >230ºC |
| Exact Mass | 554.09100 |
| LogP | 8.41360 |
| Vapour Pressure | 1.99E-09mmHg at 25°C |
| Index of Refraction | n20/D 1.5564(lit.) |
| InChIKey | TYZQQLJIRWRBFL-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)Cc1cc(I)c(CC(CC)CCCC)cc1I |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 41 |
| Safety Phrases | 26-39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2903999090 |
|
~84%
1,4-Bis(2-ethyl... CAS#:225512-46-9 |
| Literature: Lebouch, Nolwenn; Garreau, Sebastien; Louarn, Guy; Belletete, Michel; Durocher, Gilles; Leclerc, Mario Macromolecules, 2005 , vol. 38, # 23 p. 9631 - 9637 |
|
~%
1,4-Bis(2-ethyl... CAS#:225512-46-9 |
| Literature: Macromolecules, , vol. 38, # 23 p. 9631 - 9637 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD06200710 |
| di-2,5-(2-ethylhexyl)-1,6-diiodobenzene |
| 2,5-diiodo-1,4-bis(2-ethylhexyl)benzene |