Flumorph structure
|
Common Name | Flumorph | ||
|---|---|---|---|---|
| CAS Number | 211867-47-9 | Molecular Weight | 371.40200 | |
| Density | 1.208g/cm3 | Boiling Point | 556.3ºC at 760mmHg | |
| Molecular Formula | C21H22FNO4 | Melting Point | 122-125 °C | |
| MSDS | USA | Flash Point | 290.3ºC | |
Use of FlumorphFlumorph(SYP-L190) is a carboxylic acid amide (CAA) fungicide.IC50 value:Target: Fungicide agentFlumorph did not inhibit the synthesis of cell wall materials, but disturbed the polar deposition of newly synthesized cell wall materials during cystospore germination and hyphal growth. In flumorph-treated hyphae, the most characteristic change was the development of periodic swelling ("beaded" morphology) and the disruption of tip growth. Upon removing flumorph, normal tip growth and organized F-actin were observed again [1]. Flumorph had induced systemic genotoxicity in mammals as it caused DNA damage in all tested vital organs, especially in brain and spleen [2]. |
| Name | flumorph |
|---|---|
| Synonym | More Synonyms |
| Description | Flumorph(SYP-L190) is a carboxylic acid amide (CAA) fungicide.IC50 value:Target: Fungicide agentFlumorph did not inhibit the synthesis of cell wall materials, but disturbed the polar deposition of newly synthesized cell wall materials during cystospore germination and hyphal growth. In flumorph-treated hyphae, the most characteristic change was the development of periodic swelling ("beaded" morphology) and the disruption of tip growth. Upon removing flumorph, normal tip growth and organized F-actin were observed again [1]. Flumorph had induced systemic genotoxicity in mammals as it caused DNA damage in all tested vital organs, especially in brain and spleen [2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 556.3ºC at 760mmHg |
| Melting Point | 122-125 °C |
| Molecular Formula | C21H22FNO4 |
| Molecular Weight | 371.40200 |
| Flash Point | 290.3ºC |
| Exact Mass | 371.15300 |
| PSA | 48.00000 |
| LogP | 3.07130 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | BKBSMMUEEAWFRX-NBVRZTHBSA-N |
| SMILES | COc1ccc(C(=CC(=O)N2CCOCC2)c2ccc(F)cc2)cc1OC |
| Hazard Codes | Xn |
|---|---|
| RIDADR | NONH for all modes of transport |
| X5977 |
| (EZ)-4-[3-(3,4-Dimethoxyphenyl)-3-(4-fluorophenyl)acryloyl]morpholine |
| Flumorph [ISO] |
| 4-[3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-oxo-2-propen-1-yl]morpholine |
| (E)-3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-morpholin-4-ylprop-2-en-1-one |
| (2Ξ)-3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-(morpholin-4-yl)prop-2-en-1-one [50% (E)-isomer, 50% (Z)-isomer] |
| (EZ)-3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-morpholinopropenone [50% (E)-isomer, 50% (Z)-isomer] |
| 3-(3,4-Dimethoxyphenyl)-3-(4-fluorophenyl)-1-morpholinoprop-2-en-1-one |
| Flumorph |
| 4-(3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-oxo-2-propenyl)morpholine |
| (EZ)-4-[3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)acryloyl]morpholine |