methyl 3-chloro-6-fluorobenzo(b)thiophe& structure
|
Common Name | methyl 3-chloro-6-fluorobenzo(b)thiophe& | ||
|---|---|---|---|---|
| CAS Number | 21211-20-1 | Molecular Weight | 244.67000 | |
| Density | 1.464g/cm3 | Boiling Point | 342.3ºC at 760mmHg | |
| Molecular Formula | C10H6ClFO2S | Melting Point | 119-123ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 160.8ºC | |
| Name | methyl 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 342.3ºC at 760mmHg |
| Melting Point | 119-123ºC(lit.) |
| Molecular Formula | C10H6ClFO2S |
| Molecular Weight | 244.67000 |
| Flash Point | 160.8ºC |
| Exact Mass | 243.97600 |
| PSA | 54.54000 |
| LogP | 3.48040 |
| Vapour Pressure | 7.59E-05mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | GBCJKOYCWCNSAF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sc2cc(F)ccc2c1Cl |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00449849 |
| 3-Chlor-6-fluorbenzo<b>thiophen-2-carbonsaeuremethylester |