5-nitropyridine-2-thiol structure
|
Common Name | 5-nitropyridine-2-thiol | ||
|---|---|---|---|---|
| CAS Number | 2127-09-5 | Molecular Weight | 156.16200 | |
| Density | 1.48g/cm3 | Boiling Point | 220ºC at 760mmHg | |
| Molecular Formula | C5H4N2O2S | Melting Point | 188°C | |
| MSDS | N/A | Flash Point | 86.9ºC | |
| Name | 5-nitro-1H-pyridine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 220ºC at 760mmHg |
| Melting Point | 188°C |
| Molecular Formula | C5H4N2O2S |
| Molecular Weight | 156.16200 |
| Flash Point | 86.9ºC |
| Exact Mass | 155.99900 |
| PSA | 97.51000 |
| LogP | 1.80170 |
| Vapour Pressure | 0.116mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | BHQUBONFIYNJDA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(=S)[nH]c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933399090 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitropyridine-2-thiol |
| 5-nitro-2-sulfanylpyridine |
| 5-Nitro-2-pyridineethione |
| MFCD00030890 |
| 2-mercapto-4-nitropyridine |
| 5-nitro-2-mercaptopyridine |
| 2-mercapto-5-nitro-pyridine |
| 5-Nitro-2-pyridinethiol |
| 5-Nitro-2-pyridyl Mercaptan |