4-(Diphenylphosphino)benzoic acid structure
|
Common Name | 4-(Diphenylphosphino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2129-31-9 | Molecular Weight | 306.29500 | |
| Density | N/A | Boiling Point | 448ºC at 760 mmHg | |
| Molecular Formula | C19H15O2P | Melting Point | 157-160ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 224.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-diphenylphosphanylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 448ºC at 760 mmHg |
|---|---|
| Melting Point | 157-160ºC(lit.) |
| Molecular Formula | C19H15O2P |
| Molecular Weight | 306.29500 |
| Flash Point | 224.7ºC |
| Exact Mass | 306.08100 |
| PSA | 50.89000 |
| LogP | 3.14300 |
| Appearance of Characters | Crystalline Powder | White to yellow |
| Vapour Pressure | 8.24E-09mmHg at 25°C |
| InChIKey | GXMHDTPYKRTARV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00407264 |
| Ph2PC6H4COOH |
| 4-carboxyphenyldiphenylphosphine |
| 4-(diphenyl-phosphino)-benzoic acid |
| 4-Diphenylphosphanyl-benzoesaeure |
| Diphenyl(p-carboxyphenyl) phosphine |
| 4-(diphenylphosphanyl)benzonic acid |
| 4-(Diphenylphosphanyl)benzoic acid |
| 4-(Diphenylphosphino)benzoic acid |