L-Lysine,N6-[(4-methylphenyl)sulfonyl]- structure
|
Common Name | L-Lysine,N6-[(4-methylphenyl)sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 2130-76-9 | Molecular Weight | 300.37400 | |
| Density | 1.264g/cm3 | Boiling Point | 505.9ºC at 760mmHg | |
| Molecular Formula | C13H20N2O4S | Melting Point | 231-234ºC | |
| MSDS | USA | Flash Point | 259.8ºC | |
| Name | h-lys(tos)-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 505.9ºC at 760mmHg |
| Melting Point | 231-234ºC |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.37400 |
| Flash Point | 259.8ºC |
| Exact Mass | 300.11400 |
| PSA | 117.87000 |
| LogP | 3.02750 |
| Appearance of Characters | Powder | Off-white |
| Vapour Pressure | 4.67E-11mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | FRJAAXSHLGSWAP-LBPRGKRZSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCC(N)C(=O)O)cc1 |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 24/25-37/39-26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
|
~%
L-Lysine,N6-[(4... CAS#:2130-76-9 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 5883,5886 Journal of the American Chemical Society, , vol. 81, p. 3055,3057 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-E-TOSYL-L-LYSINE |
| N6-Tosyl-L-lysine |
| NE-P-TOSYL-L-LYSINE |
| Nepsilon-Tosyl-L-lysine |
| MFCD00020392 |
| N~6~-[(4-methylphenyl)sulfonyl]lysine |