bis(2-ethylhexyl) glutarate structure
|
Common Name | bis(2-ethylhexyl) glutarate | ||
|---|---|---|---|---|
| CAS Number | 21302-20-5 | Molecular Weight | 356.54000 | |
| Density | 0.931g/cm3 | Boiling Point | 371ºC at 760mmHg | |
| Molecular Formula | C21H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.5ºC | |
| Name | bis(2-ethylhexyl) pentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.931g/cm3 |
|---|---|
| Boiling Point | 371ºC at 760mmHg |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.54000 |
| Flash Point | 163.5ºC |
| Exact Mass | 356.29300 |
| PSA | 52.60000 |
| LogP | 5.67590 |
| Vapour Pressure | 1.06E-05mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | ABXLQQAKBRIHIT-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)CCCC(=O)OCC(CC)CCCC |
| HS Code | 2917190090 |
|---|
|
~%
bis(2-ethylhexy... CAS#:21302-20-5 |
| Literature: Iwakura Kobunshi Kagaku, 1945 , vol. 2, p. 287,296 Chem.Abstr., 1950 , p. 5144 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| glutaric acid bis-(2-ethyl-hexyl ester) |
| EINECS 244-326-3 |
| Pentanedioic acid,bis(2-ethylhexyl) ester |
| di-2-ethylhexyl glutarate |
| Bis(2-ethylhexyl) glutarate |
| Glutarsaeure-bis-(2-aethyl-hexylester) |
| Di-2-ethylhexylglutarat |