ethyl (E)-3-(4-nitrophenyl)-3-phenyl-prop-2-enoate structure
|
Common Name | ethyl (E)-3-(4-nitrophenyl)-3-phenyl-prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 21320-81-0 | Molecular Weight | 297.30500 | |
| Density | 1.212g/cm3 | Boiling Point | 419.2ºC at 760 mmHg | |
| Molecular Formula | C17H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | ethyl 3-(4-nitrophenyl)-3-phenylprop-2-enoate |
|---|
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 419.2ºC at 760 mmHg |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.30500 |
| Flash Point | 167.3ºC |
| Exact Mass | 297.10000 |
| PSA | 72.12000 |
| LogP | 4.11280 |
| Vapour Pressure | 3.1E-07mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | XEKGHLBHNMAJKY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
|
~55%
ethyl (E)-3-(4-... CAS#:21320-81-0 |
| Literature: Masson, Christophe; Caumont-Bertrand, Karine Patent: US2011/195993 A1, 2011 ; Location in patent: Page/Page column 12; 21 ; US 20110195993 A1 |
|
~96%
ethyl (E)-3-(4-... CAS#:21320-81-0 |
| Literature: Calo, Vincenzo; Nacci, Angelo; Monopoli, Antonio; Laera, Stefania; Cioffi, Nicola Journal of Organic Chemistry, 2003 , vol. 68, # 7 p. 2929 - 2933 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |