4-hydroxy-5-(phenylamino)naphthalene-2,7-disulfonic acid structure
|
Common Name | 4-hydroxy-5-(phenylamino)naphthalene-2,7-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 213249-11-7 | Molecular Weight | 395.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-anilino-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO7S2 |
|---|---|
| Molecular Weight | 395.40700 |
| Exact Mass | 395.01300 |
| PSA | 157.76000 |
| LogP | 5.01700 |
| InChIKey | VLRYLEVQHPQKBV-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(O)c2c(Nc3ccccc3)cc(S(=O)(=O)O)cc2c1 |
|
~%
4-hydroxy-5-(ph... CAS#:213249-11-7 |
| Literature: Bayer and Co. Patent: DE181929 ; |
|
~%
4-hydroxy-5-(ph... CAS#:213249-11-7 |
| Literature: Bayer and Co. Patent: DE181929 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Anilino-5-hydroxy-2,7-naphthalenedisulfonicacid |
| 1-phenylamino-8-naphthol-3,6-disulphonic acid |
| N-Phenyl-H acid |
| 4-Anilino-5-hydroxy-naphthalin-2,7-disulfonsaeure |
| 4-anilino-5-hydroxy-naphthalene-2,7-disulfonic acid |