8-Amino-1-naphthol-3,6-disulfonic acid monosodium salt monohydrate structure
|
Common Name | 8-Amino-1-naphthol-3,6-disulfonic acid monosodium salt monohydrate | ||
|---|---|---|---|---|
| CAS Number | 5460-09-3 | Molecular Weight | 340.285 | |
| Density | 1.88g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10NNaO8S2 | Melting Point | >300°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Amino-1-Naphthol-3,6-Disulfonic Acid Monosodium Salt Monohydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Melting Point | >300°C |
| Molecular Formula | C10H10NNaO8S2 |
| Molecular Weight | 340.285 |
| Exact Mass | 339.956696 |
| PSA | 183.81000 |
| LogP | 2.95690 |
| InChIKey | QPILZZVXGUNELN-UHFFFAOYSA-M |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)[O-])cc(O)c12.[Na+] |
| Storage condition | Refrigerator |
| Water Solubility | slightly soluble |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,7-Naphthalenedisulfonate, 4-amino-5-hydroxy-, sodium salt (1:1) |
| MFCD00036444 |
| 8-Amino-1-naphthol-3,6-disulfonic acid monosodium salt monohydrate |
| EINECS 226-736-4 |