1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid structure
|
Common Name | 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 90-20-0 | Molecular Weight | 319.311 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO7S2 | Melting Point | >300 °C(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C10H9NO7S2 |
| Molecular Weight | 319.311 |
| Exact Mass | 318.982056 |
| PSA | 171.75000 |
| LogP | -3.45 |
| Index of Refraction | 1.764 |
| InChIKey | APRRQJCCBSJQOQ-UHFFFAOYSA-N |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-Amino-8-hydro... CAS#:90-20-0 |
| Literature: DE69722 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 468 |
|
~%
1-Amino-8-hydro... CAS#:90-20-0 |
| Literature: DE67062 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 466 |
|
~%
1-Amino-8-hydro... CAS#:90-20-0 |
| Literature: DE67062 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 466 |
|
~%
1-Amino-8-hydro... CAS#:90-20-0 |
| Literature: DE69963 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 467 |
|
~%
1-Amino-8-hydro... CAS#:90-20-0 |
| Literature: Chemische Berichte, , vol. 27, p. 2141 |
|
~%
1-Amino-8-hydro... CAS#:90-20-0 |
| Literature: DE113944 ; |
|
~%
1-Amino-8-hydro... CAS#:90-20-0 |
| Literature: DE147852 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 10 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| H Acids |
| kyselina1-amino-8-naftol-3,6-disulfonova |
| 1-AMINO-8-NAPHTHOL-3,6-DISULFONIC ACID |
| 1-Amino-8-naphthol-3,6-disulphonicacid |
| 1-amino-8-hydroxynaphtalene-3,6-disulfonic acid |
| 4-hydroxy-5-amino-2,7-naphthalenedisulfonic acid |
| kyselinah |
| 8-AMINO-1-NAPHTHOL-3,6-DISULFONIC ACID |
| 1-amino-8-hydroxynaphthalene-3,6-disulfonic acid |
| MFCD00035728 |
| EINECS 201-975-7 |
| Sulfonphthol |
| 1-Naphthol-8-amino-3,6-disulfonicacid |
| kyselina8-amino-1-naftol-3,6-disulfonova |
| 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid |
| 1-hydroxy-8-aminonaphthalene-3,6-disulfonic acid |
| 1-Amino-8-hydroxy-3,6-disulfonaphthalene |
| 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: Molecular weight of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid is 319.311. |
| Q: What is the InChIKey of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: InChIKey of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid is APRRQJCCBSJQOQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: Molecular formula of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid is C10H9NO7S2. |
| Q: What is the safety information for 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: Safety information for 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid: S26-S36. |
| Q: What is the polar surface area (PSA) of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: Polar surface area (PSA) of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid is 171.75000. |
| Q: What are the downstream products of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: Related downstream products(CAS) of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid: 3769-62-8;213249-11-7;19668-12-3;2203-16-9;81-16-3;72-57-1;130-23-4;134-34-9;3567-66-6;148-25-4. |
| Q: What is the melting point of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: Melting point of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid is >300 °C(lit.). |
| Q: What is the LogP of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: LogP of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid is -3.45. |
| Q: What is the SMILES notation of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: SMILES notation of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid is Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12. |
| Q: What is the CAS number of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid? |
| A: CAS number of 1-Amino-8-hydroxynaphthalene-3,6-disulphonic acid is 90-20-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |