n-benzoyl-dl-phenylalanine 2-naphthyl ester structure
|
Common Name | n-benzoyl-dl-phenylalanine 2-naphthyl ester | ||
|---|---|---|---|---|
| CAS Number | 2134-24-9 | Molecular Weight | 395.45000 | |
| Density | 1.222g/cm3 | Boiling Point | 656.6ºC at 760mmHg | |
| Molecular Formula | C26H21NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 350.9ºC | |
| Name | n-benzoyl-dl-phenylalanine 2-naphthyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 656.6ºC at 760mmHg |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.45000 |
| Flash Point | 350.9ºC |
| Exact Mass | 395.15200 |
| PSA | 55.40000 |
| LogP | 5.17740 |
| Vapour Pressure | 4.1E-17mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | NPPKNSHRAVHLHD-UHFFFAOYSA-N |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)Oc1ccc2ccccc2c1)c1ccccc1 |
| Storage condition | −20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~%
n-benzoyl-dl-ph... CAS#:2134-24-9 |
| Literature: Ravin et al. Journal of Biological Chemistry, 1954 , vol. 208, p. 1,2 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Benzamido-3-phenyl-propionitril |
| N-Benzoyl-phenylalanin-nitril |
| 2-benzoylamino-3-phenyl-propionic acid naphthalene-2-yl ester |
| N-benzoyl-phenylalanine nitrile |
| 2-naphthyl N-benzoyl-3-phenyl-DL-alaninate |
| 2-benzamido-3-phenylpropanenitrile |
| MFCD00021607 |
| EINECS 218-364-6 |