3-phenyl-3-propylpiperidine-2,6-dione structure
|
Common Name | 3-phenyl-3-propylpiperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 21389-09-3 | Molecular Weight | 231.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenyl-3-propylpiperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17NO2 |
|---|---|
| Molecular Weight | 231.29000 |
| Exact Mass | 231.12600 |
| PSA | 49.66000 |
| LogP | 2.43700 |
| InChIKey | CXDAXBRLSATHRS-UHFFFAOYSA-N |
| SMILES | CCCC1(c2ccccc2)CCC(=O)NC1=O |
|
~89%
3-phenyl-3-prop... CAS#:21389-09-3 |
| Literature: Knabe, Joachim; Reischig, Dirk Archiv der Pharmazie (Weinheim, Germany), 1984 , vol. 317, # 4 p. 353 - 362 |
|
~56%
3-phenyl-3-prop... CAS#:21389-09-3 |
| Literature: Hartmann, Rolf W.; Batzl, Christine Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1362 - 1369 |
|
~%
3-phenyl-3-prop... CAS#:21389-09-3 |
| Literature: Hartmann, Rolf W.; Batzl, Christine Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1362 - 1369 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Phenyl-3-propyl-piperidin-2,6-dion |
| 3-phenyl-3-propyl-piperidine-2,6-dione |
| 2,6-Piperidinedione,3-phenyl-3-propyl |